C30H31NO5 — CID 6969446
cyclohexyl (4R,7S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 6969446) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is cyclohexyl (4R,7S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | cyclohexyl (4R,7S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 6969446 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | cyclohexyl (4R,7S)-4-(1,3-benzodioxol-5-yl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CC1=NC2=C(C(=O)C[C@@H](c3ccccc3)C2)[C@@H](c2ccc3c(c2)OCO3)C1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C30H31NO5/c1-18-27(30(33)36-22-10-6-3-7-11-22)28(20-12-13-25-26(16-20)35-17-34-25)29-23(31-18)14-21(15-24(29)32)19-8-4-2-5-9-19/h2,4-5,8-9,12-13,16,21-22,27-28H,3,6-7,10-11,14-15,17H2,1H3/t21-,27?,28-/m0/s1 |
| InChIKey | GTDCFLBSMJTOST-GHSRMECKSA-N |
| XLogP | 5.87 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |