C31H36N2O3 — CID 7869965
cyclohexyl (4S,7S)-4-[4-(dimethylamino)phenyl]-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7869965) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is cyclohexyl (4S,7S)-4-[4-(dimethylamino)phenyl]-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | cyclohexyl (4S,7S)-4-[4-(dimethylamino)phenyl]-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7869965 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | cyclohexyl (4S,7S)-4-[4-(dimethylamino)phenyl]-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CC1=NC2=C(C(=O)C[C@@H](c3ccccc3)C2)[C@H](c2ccc(N(C)C)cc2)C1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C31H36N2O3/c1-20-28(31(35)36-25-12-8-5-9-13-25)29(22-14-16-24(17-15-22)33(2)3)30-26(32-20)18-23(19-27(30)34)21-10-6-4-7-11-21/h4,6-7,10-11,14-17,23,25,28-29H,5,8-9,12-13,18-19H2,1-3H3/t23-,28?,29+/m0/s1 |
| InChIKey | NHELRJMSOPIZBB-SJAHEGMPSA-N |
| XLogP | 6.20 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|