C32H37NO6 — CID 7089641
cyclohexyl (4S,7S)-2-methyl-5-oxo-7-phenyl-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7089641) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is cyclohexyl (4S,7S)-2-methyl-5-oxo-7-phenyl-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | cyclohexyl (4S,7S)-2-methyl-5-oxo-7-phenyl-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7089641 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | cyclohexyl (4S,7S)-2-methyl-5-oxo-7-phenyl-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COc1cc([C@H]2C3=C(C[C@H](c4ccccc4)CC3=O)N=C(C)C2C(=O)OC2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C32H37NO6/c1-19-28(32(35)39-23-13-9-6-10-14-23)29(22-17-26(36-2)31(38-4)27(18-22)37-3)30-24(33-19)15-21(16-25(30)34)20-11-7-5-8-12-20/h5,7-8,11-12,17-18,21,23,28-29H,6,9-10,13-16H2,1-4H3/t21-,28?,29+/m0/s1 |
| InChIKey | XGQGVTHGAKMYGO-LZQCMRJQSA-N |
| XLogP | 6.16 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |