C4H11NO — CID 71776283
2-amino-1,1,1,4,4,4-hexadeuteriobutan-2-ol (PubChem CID 71776283) has the molecular formula C4H11NO and a molecular weight of 95.17 g/mol. Its IUPAC name is 2-amino-1,1,1,4,4,4-hexadeuteriobutan-2-ol.
| Compound Name | 2-amino-1,1,1,4,4,4-hexadeuteriobutan-2-ol |
|---|---|
| PubChem CID | 71776283 |
| Molecular Formula | C4H11NO |
| Molecular Weight | 95.17 g/mol |
| Exact Mass | 95.12 |
| IUPAC Name | 2-amino-1,1,1,4,4,4-hexadeuteriobutan-2-ol |
| SMILES | [2H]C([2H])([2H])CC(N)(O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C4H11NO/c1-3-4(2,5)6/h6H,3,5H2,1-2H3/i1D3,2D3 |
| InChIKey | VKPHHYUEMRNFSX-WFGJKAKNSA-N |
| XLogP | 0.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 95.17 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|