C20H20N4O7S — CID 71780708
1-(furan-2-yl)-2-[4-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)piperazin-1-yl]ethanone;oxalic acid (PubChem CID 71780708) has the molecular formula C20H20N4O7S and a molecular weight of 460.47 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[4-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)piperazin-1-yl]ethanone;oxalic acid.
| Compound Name | 1-(furan-2-yl)-2-[4-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)piperazin-1-yl]ethanone;oxalic acid |
|---|---|
| PubChem CID | 71780708 |
| Molecular Formula | C20H20N4O7S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 1-(furan-2-yl)-2-[4-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)piperazin-1-yl]ethanone;oxalic acid |
| SMILES | O=C(CN1CCN(C(=O)c2cc(-c3cccs3)[nH]n2)CC1)c1ccco1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H18N4O3S.C2H2O4/c23-15(16-3-1-9-25-16)12-21-5-7-22(8-6-21)18(24)14-11-13(19-20-14)17-4-2-10-26-17;3-1(4)2(5)6/h1-4,9-11H,5-8,12H2,(H,19,20);(H,3,4)(H,5,6) |
| InChIKey | OIRMSLNLCALUIF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 157.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|