C17H19N3O8 — CID 71780728
1-(furan-2-yl)-2-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]ethanone;oxalic acid (PubChem CID 71780728) has the molecular formula C17H19N3O8 and a molecular weight of 393.35 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]ethanone;oxalic acid.
| Compound Name | 1-(furan-2-yl)-2-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]ethanone;oxalic acid |
|---|---|
| PubChem CID | 71780728 |
| Molecular Formula | C17H19N3O8 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-(furan-2-yl)-2-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]ethanone;oxalic acid |
| SMILES | Cc1cc(C(=O)N2CCN(CC(=O)c3ccco3)CC2)no1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H17N3O4.C2H2O4/c1-11-9-12(16-22-11)15(20)18-6-4-17(5-7-18)10-13(19)14-3-2-8-21-14;3-1(4)2(5)6/h2-3,8-9H,4-7,10H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | CYKJEQHXOKUPQC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 154.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|