C14H21N3O8S — CID 121077548
4-[2-(furan-2-yl)-2-oxoethyl]-N,N-dimethylpiperazine-1-sulfonamide;oxalic acid (PubChem CID 121077548) has the molecular formula C14H21N3O8S and a molecular weight of 391.40 g/mol. Its IUPAC name is 4-[2-(furan-2-yl)-2-oxoethyl]-N,N-dimethylpiperazine-1-sulfonamide;oxalic acid.
| Compound Name | 4-[2-(furan-2-yl)-2-oxoethyl]-N,N-dimethylpiperazine-1-sulfonamide;oxalic acid |
|---|---|
| PubChem CID | 121077548 |
| Molecular Formula | C14H21N3O8S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 4-[2-(furan-2-yl)-2-oxoethyl]-N,N-dimethylpiperazine-1-sulfonamide;oxalic acid |
| SMILES | CN(C)S(=O)(=O)N1CCN(CC(=O)c2ccco2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H19N3O4S.C2H2O4/c1-13(2)20(17,18)15-7-5-14(6-8-15)10-11(16)12-4-3-9-19-12;3-1(4)2(5)6/h3-4,9H,5-8,10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | MGJLLRDMJHRJLV-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|