C18H22N4O8 — CID 71780727
1-(furan-2-yl)-2-[4-(3-methoxy-1-methylpyrazole-4-carbonyl)piperazin-1-yl]ethanone;oxalic acid (PubChem CID 71780727) has the molecular formula C18H22N4O8 and a molecular weight of 422.39 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[4-(3-methoxy-1-methylpyrazole-4-carbonyl)piperazin-1-yl]ethanone;oxalic acid.
| Compound Name | 1-(furan-2-yl)-2-[4-(3-methoxy-1-methylpyrazole-4-carbonyl)piperazin-1-yl]ethanone;oxalic acid |
|---|---|
| PubChem CID | 71780727 |
| Molecular Formula | C18H22N4O8 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 1-(furan-2-yl)-2-[4-(3-methoxy-1-methylpyrazole-4-carbonyl)piperazin-1-yl]ethanone;oxalic acid |
| SMILES | COc1nn(C)cc1C(=O)N1CCN(CC(=O)c2ccco2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H20N4O4.C2H2O4/c1-18-10-12(15(17-18)23-2)16(22)20-7-5-19(6-8-20)11-13(21)14-4-3-9-24-14;3-1(4)2(5)6/h3-4,9-10H,5-8,11H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | VWFHGBNARHAXRU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 155.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|