C15H16N2O4 — CID 71782588
N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-phenyloxamide (PubChem CID 71782588) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-phenyloxamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-phenyloxamide |
|---|---|
| PubChem CID | 71782588 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-N'-phenyloxamide |
| SMILES | CC(O)(CNC(=O)C(=O)Nc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C15H16N2O4/c1-15(20,12-8-5-9-21-12)10-16-13(18)14(19)17-11-6-3-2-4-7-11/h2-9,20H,10H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | XBLCQTBRDMNEDO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|