C18H18N4O7S — CID 71784003
N-(furan-2-ylmethyl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetamide;oxalic acid (PubChem CID 71784003) has the molecular formula C18H18N4O7S and a molecular weight of 434.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetamide;oxalic acid.
| Compound Name | N-(furan-2-ylmethyl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 71784003 |
| Molecular Formula | C18H18N4O7S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetamide;oxalic acid |
| SMILES | O=C(CN1CC(c2nc(-c3cccs3)no2)C1)NCc1ccco1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H16N4O3S.C2H2O4/c21-14(17-7-12-3-1-5-22-12)10-20-8-11(9-20)16-18-15(19-23-16)13-4-2-6-24-13;3-1(4)2(5)6/h1-6,11H,7-10H2,(H,17,21);(H,3,4)(H,5,6) |
| InChIKey | LGWBUIHKHQJGIN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 159.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|