C19H16F3N5O6S — CID 71784146
oxalic acid;N-(1,3-thiazol-2-yl)-2-[3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]azetidin-1-yl]acetamide (PubChem CID 71784146) has the molecular formula C19H16F3N5O6S and a molecular weight of 499.43 g/mol. Its IUPAC name is oxalic acid;N-(1,3-thiazol-2-yl)-2-[3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]azetidin-1-yl]acetamide.
| Compound Name | oxalic acid;N-(1,3-thiazol-2-yl)-2-[3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]azetidin-1-yl]acetamide |
|---|---|
| PubChem CID | 71784146 |
| Molecular Formula | C19H16F3N5O6S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | oxalic acid;N-(1,3-thiazol-2-yl)-2-[3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]azetidin-1-yl]acetamide |
| SMILES | O=C(CN1CC(c2nc(-c3cccc(C(F)(F)F)c3)no2)C1)Nc1nccs1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H14F3N5O2S.C2H2O4/c18-17(19,20)12-3-1-2-10(6-12)14-23-15(27-24-14)11-7-25(8-11)9-13(26)22-16-21-4-5-28-16;3-1(4)2(5)6/h1-6,11H,7-9H2,(H,21,22,26);(H,3,4)(H,5,6) |
| InChIKey | LDQWXFKDBOQTGB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 158.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|