C23H37N3O5 — CID 71784743
1-[4-[(2,4-dimethylpiperazin-1-yl)methyl]piperidin-1-yl]-2-(3-methylphenyl)ethanone;formic acid (PubChem CID 71784743) has the molecular formula C23H37N3O5 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-[4-[(2,4-dimethylpiperazin-1-yl)methyl]piperidin-1-yl]-2-(3-methylphenyl)ethanone;formic acid.
| Compound Name | 1-[4-[(2,4-dimethylpiperazin-1-yl)methyl]piperidin-1-yl]-2-(3-methylphenyl)ethanone;formic acid |
|---|---|
| PubChem CID | 71784743 |
| Molecular Formula | C23H37N3O5 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 1-[4-[(2,4-dimethylpiperazin-1-yl)methyl]piperidin-1-yl]-2-(3-methylphenyl)ethanone;formic acid |
| SMILES | Cc1cccc(CC(=O)N2CCC(CN3CCN(C)CC3C)CC2)c1.O=CO.O=CO |
| InChI | InChI=1S/C21H33N3O.2CH2O2/c1-17-5-4-6-20(13-17)14-21(25)23-9-7-19(8-10-23)16-24-12-11-22(3)15-18(24)2;2*2-1-3/h4-6,13,18-19H,7-12,14-16H2,1-3H3;2*1H,(H,2,3) |
| InChIKey | MTUHWIGAWWNCFM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|