C22H34FN3O5 — CID 71784751
1-[4-[(2,4-dimethylpiperazin-1-yl)methyl]piperidin-1-yl]-2-(4-fluorophenyl)ethanone;formic acid (PubChem CID 71784751) has the molecular formula C22H34FN3O5 and a molecular weight of 439.53 g/mol. Its IUPAC name is 1-[4-[(2,4-dimethylpiperazin-1-yl)methyl]piperidin-1-yl]-2-(4-fluorophenyl)ethanone;formic acid.
| Compound Name | 1-[4-[(2,4-dimethylpiperazin-1-yl)methyl]piperidin-1-yl]-2-(4-fluorophenyl)ethanone;formic acid |
|---|---|
| PubChem CID | 71784751 |
| Molecular Formula | C22H34FN3O5 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 1-[4-[(2,4-dimethylpiperazin-1-yl)methyl]piperidin-1-yl]-2-(4-fluorophenyl)ethanone;formic acid |
| SMILES | CC1CN(C)CCN1CC1CCN(C(=O)Cc2ccc(F)cc2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C20H30FN3O.2CH2O2/c1-16-14-22(2)11-12-24(16)15-18-7-9-23(10-8-18)20(25)13-17-3-5-19(21)6-4-17;2*2-1-3/h3-6,16,18H,7-15H2,1-2H3;2*1H,(H,2,3) |
| InChIKey | JGUVBCQOZZGNEP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|