C14H22N2O6 — CID 71785985
formic acid;furan-2-yl-[3-[[2-hydroxyethyl(methyl)amino]methyl]morpholin-4-yl]methanone (PubChem CID 71785985) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is formic acid;furan-2-yl-[3-[[2-hydroxyethyl(methyl)amino]methyl]morpholin-4-yl]methanone.
| Compound Name | formic acid;furan-2-yl-[3-[[2-hydroxyethyl(methyl)amino]methyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 71785985 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | formic acid;furan-2-yl-[3-[[2-hydroxyethyl(methyl)amino]methyl]morpholin-4-yl]methanone |
| SMILES | CN(CCO)CC1COCCN1C(=O)c1ccco1.O=CO |
| InChI | InChI=1S/C13H20N2O4.CH2O2/c1-14(4-6-16)9-11-10-18-8-5-15(11)13(17)12-3-2-7-19-12;2-1-3/h2-3,7,11,16H,4-6,8-10H2,1H3;1H,(H,2,3) |
| InChIKey | XNLUNWSWTJOIAL-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|