C13H21NO2S — CID 71787573
N-(3-hydroxy-4,4-dimethylpentyl)-2-thiophen-2-ylacetamide (PubChem CID 71787573) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is N-(3-hydroxy-4,4-dimethylpentyl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(3-hydroxy-4,4-dimethylpentyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 71787573 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-(3-hydroxy-4,4-dimethylpentyl)-2-thiophen-2-ylacetamide |
| SMILES | CC(C)(C)C(O)CCNC(=O)Cc1cccs1 |
| InChI | InChI=1S/C13H21NO2S/c1-13(2,3)11(15)6-7-14-12(16)9-10-5-4-8-17-10/h4-5,8,11,15H,6-7,9H2,1-3H3,(H,14,16) |
| InChIKey | JTAWICBRIDVXFL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |