C19H21N3O2 — CID 71788722
1-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]-3-(2-methylphenyl)urea (PubChem CID 71788722) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 71788722 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NCC(O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C19H21N3O2/c1-13-7-3-5-9-16(13)21-19(24)20-11-18(23)15-12-22(2)17-10-6-4-8-14(15)17/h3-10,12,18,23H,11H2,1-2H3,(H2,20,21,24) |
| InChIKey | MLKJBKADGMIGQP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |