C21H23N3O3 — CID 90535246
N'-(2,6-dimethylphenyl)-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]oxamide (PubChem CID 90535246) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]oxamide.
| Compound Name | N'-(2,6-dimethylphenyl)-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 90535246 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]oxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(=O)NCC(O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C21H23N3O3/c1-13-7-6-8-14(2)19(13)23-21(27)20(26)22-11-18(25)16-12-24(3)17-10-5-4-9-15(16)17/h4-10,12,18,25H,11H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | NUNLVCFGSMPUHQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|