C16H22N4O2 — CID 71789054
1-(2-methoxyethyl)-3-[3-(2-phenylimidazol-1-yl)propyl]urea (PubChem CID 71789054) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[3-(2-phenylimidazol-1-yl)propyl]urea.
| Compound Name | 1-(2-methoxyethyl)-3-[3-(2-phenylimidazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 71789054 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[3-(2-phenylimidazol-1-yl)propyl]urea |
| SMILES | COCCNC(=O)NCCCn1ccnc1-c1ccccc1 |
| InChI | InChI=1S/C16H22N4O2/c1-22-13-10-19-16(21)18-8-5-11-20-12-9-17-15(20)14-6-3-2-4-7-14/h2-4,6-7,9,12H,5,8,10-11,13H2,1H3,(H2,18,19,21) |
| InChIKey | JJAPVIGWYHVRSE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|