C15H13ClN6O — CID 71789920
1-(2-chlorophenyl)-3-[2-(2-methylimidazol-1-yl)pyrimidin-5-yl]urea (PubChem CID 71789920) has the molecular formula C15H13ClN6O and a molecular weight of 328.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-(2-methylimidazol-1-yl)pyrimidin-5-yl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-(2-methylimidazol-1-yl)pyrimidin-5-yl]urea |
|---|---|
| PubChem CID | 71789920 |
| Molecular Formula | C15H13ClN6O |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-(2-methylimidazol-1-yl)pyrimidin-5-yl]urea |
| SMILES | Cc1nccn1-c1ncc(NC(=O)Nc2ccccc2Cl)cn1 |
| InChI | InChI=1S/C15H13ClN6O/c1-10-17-6-7-22(10)14-18-8-11(9-19-14)20-15(23)21-13-5-3-2-4-12(13)16/h2-9H,1H3,(H2,20,21,23) |
| InChIKey | HUCBUXKYDQRKOW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |