C14H14N6O2S — CID 71791001
1-[4-(4-methyl-5-oxotetrazol-1-yl)phenyl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 71791001) has the molecular formula C14H14N6O2S and a molecular weight of 330.37 g/mol. Its IUPAC name is 1-[4-(4-methyl-5-oxotetrazol-1-yl)phenyl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[4-(4-methyl-5-oxotetrazol-1-yl)phenyl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 71791001 |
| Molecular Formula | C14H14N6O2S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1-[4-(4-methyl-5-oxotetrazol-1-yl)phenyl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | Cn1nnn(-c2ccc(NC(=O)NCc3cccs3)cc2)c1=O |
| InChI | InChI=1S/C14H14N6O2S/c1-19-14(22)20(18-17-19)11-6-4-10(5-7-11)16-13(21)15-9-12-3-2-8-23-12/h2-8H,9H2,1H3,(H2,15,16,21) |
| InChIKey | ICGQFBJPYNBGPK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |