C18H23N3O2S — CID 129470856
1-[4-[(1R)-1-morpholin-4-ylethyl]phenyl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 129470856) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[4-[(1R)-1-morpholin-4-ylethyl]phenyl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[4-[(1R)-1-morpholin-4-ylethyl]phenyl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 129470856 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[4-[(1R)-1-morpholin-4-ylethyl]phenyl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | C[C@H](c1ccc(NC(=O)NCc2cccs2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C18H23N3O2S/c1-14(21-8-10-23-11-9-21)15-4-6-16(7-5-15)20-18(22)19-13-17-3-2-12-24-17/h2-7,12,14H,8-11,13H2,1H3,(H2,19,20,22)/t14-/m1/s1 |
| InChIKey | CHBXIOHWNDXRBY-CQSZACIVSA-N |
| XLogP | 3.46 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |