C22H30N4O2 — CID 97020119
1-[(2R)-1-anilinopropan-2-yl]-3-[4-[(1R)-1-morpholin-4-ylethyl]phenyl]urea (PubChem CID 97020119) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-[(2R)-1-anilinopropan-2-yl]-3-[4-[(1R)-1-morpholin-4-ylethyl]phenyl]urea.
| Compound Name | 1-[(2R)-1-anilinopropan-2-yl]-3-[4-[(1R)-1-morpholin-4-ylethyl]phenyl]urea |
|---|---|
| PubChem CID | 97020119 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1-[(2R)-1-anilinopropan-2-yl]-3-[4-[(1R)-1-morpholin-4-ylethyl]phenyl]urea |
| SMILES | C[C@H](CNc1ccccc1)NC(=O)Nc1ccc([C@@H](C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H30N4O2/c1-17(16-23-20-6-4-3-5-7-20)24-22(27)25-21-10-8-19(9-11-21)18(2)26-12-14-28-15-13-26/h3-11,17-18,23H,12-16H2,1-2H3,(H2,24,25,27)/t17-,18-/m1/s1 |
| InChIKey | YDONTRJGHORUBI-QZTJIDSGSA-N |
| XLogP | 3.70 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |