C15H11ClFN5O2 — CID 71791453
N-(5-chloro-2-methoxyphenyl)-2-(4-fluorophenyl)tetrazole-5-carboxamide (PubChem CID 71791453) has the molecular formula C15H11ClFN5O2 and a molecular weight of 347.74 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-(4-fluorophenyl)tetrazole-5-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-(4-fluorophenyl)tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 71791453 |
| Molecular Formula | C15H11ClFN5O2 |
| Molecular Weight | 347.74 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-(4-fluorophenyl)tetrazole-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1nnn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H11ClFN5O2/c1-24-13-7-2-9(16)8-12(13)18-15(23)14-19-21-22(20-14)11-5-3-10(17)4-6-11/h2-8H,1H3,(H,18,23) |
| InChIKey | KNVCRRNYGLDCLF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.74 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |