C14H7BrF3N5O — CID 71791714
2-(4-bromophenyl)-N-(2,3,4-trifluorophenyl)tetrazole-5-carboxamide (PubChem CID 71791714) has the molecular formula C14H7BrF3N5O and a molecular weight of 398.14 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(2,3,4-trifluorophenyl)tetrazole-5-carboxamide.
| Compound Name | 2-(4-bromophenyl)-N-(2,3,4-trifluorophenyl)tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 71791714 |
| Molecular Formula | C14H7BrF3N5O |
| Molecular Weight | 398.14 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 2-(4-bromophenyl)-N-(2,3,4-trifluorophenyl)tetrazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1nnn(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C14H7BrF3N5O/c15-7-1-3-8(4-2-7)23-21-13(20-22-23)14(24)19-10-6-5-9(16)11(17)12(10)18/h1-6H,(H,19,24) |
| InChIKey | SJBYZINLKRREEZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.14 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|