C22H23FN4O2S — CID 71793990
N-[1-[6-(3-fluorophenyl)pyridazin-3-yl]piperidin-4-yl]-1-phenylmethanesulfonamide (PubChem CID 71793990) has the molecular formula C22H23FN4O2S and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[1-[6-(3-fluorophenyl)pyridazin-3-yl]piperidin-4-yl]-1-phenylmethanesulfonamide.
| Compound Name | N-[1-[6-(3-fluorophenyl)pyridazin-3-yl]piperidin-4-yl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 71793990 |
| Molecular Formula | C22H23FN4O2S |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[1-[6-(3-fluorophenyl)pyridazin-3-yl]piperidin-4-yl]-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)NC1CCN(c2ccc(-c3cccc(F)c3)nn2)CC1 |
| InChI | InChI=1S/C22H23FN4O2S/c23-19-8-4-7-18(15-19)21-9-10-22(25-24-21)27-13-11-20(12-14-27)26-30(28,29)16-17-5-2-1-3-6-17/h1-10,15,20,26H,11-14,16H2 |
| InChIKey | FMRFQPGZKSAOPD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |