C14H18F3N3O2 — CID 71797031
N-[2-[4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-ethoxyacetamide (PubChem CID 71797031) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-[2-[4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-ethoxyacetamide.
| Compound Name | N-[2-[4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 71797031 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[2-[4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-ethoxyacetamide |
| SMILES | CCOCC(=O)NCCc1nc(C2CC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H18F3N3O2/c1-2-22-8-13(21)18-6-5-12-19-10(9-3-4-9)7-11(20-12)14(15,16)17/h7,9H,2-6,8H2,1H3,(H,18,21) |
| InChIKey | JBANHLZVTXGXDX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |