C17H18FN3O4S — CID 71797278
3-fluoro-N-[2-[4-(furan-2-yl)-1-methylimidazol-2-yl]ethyl]-4-methoxybenzenesulfonamide (PubChem CID 71797278) has the molecular formula C17H18FN3O4S and a molecular weight of 379.41 g/mol. Its IUPAC name is 3-fluoro-N-[2-[4-(furan-2-yl)-1-methylimidazol-2-yl]ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-fluoro-N-[2-[4-(furan-2-yl)-1-methylimidazol-2-yl]ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 71797278 |
| Molecular Formula | C17H18FN3O4S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 3-fluoro-N-[2-[4-(furan-2-yl)-1-methylimidazol-2-yl]ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCc2nc(-c3ccco3)cn2C)cc1F |
| InChI | InChI=1S/C17H18FN3O4S/c1-21-11-14(16-4-3-9-25-16)20-17(21)7-8-19-26(22,23)12-5-6-15(24-2)13(18)10-12/h3-6,9-11,19H,7-8H2,1-2H3 |
| InChIKey | HRSAFVPOKPKYDU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |