C11H7F3N2O2 — CID 71797723
N-(1,2-oxazol-4-yl)-2-(trifluoromethyl)benzamide (PubChem CID 71797723) has the molecular formula C11H7F3N2O2 and a molecular weight of 256.18 g/mol. Its IUPAC name is N-(1,2-oxazol-4-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | N-(1,2-oxazol-4-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 71797723 |
| Molecular Formula | C11H7F3N2O2 |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | N-(1,2-oxazol-4-yl)-2-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cnoc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H7F3N2O2/c12-11(13,14)9-4-2-1-3-8(9)10(17)16-7-5-15-18-6-7/h1-6H,(H,16,17) |
| InChIKey | TYYCFRRYGMBYFN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |