C11H11N3O2 — CID 62913787
2-(methylamino)-N-(1,2-oxazol-4-yl)benzamide (PubChem CID 62913787) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-(methylamino)-N-(1,2-oxazol-4-yl)benzamide.
| Compound Name | 2-(methylamino)-N-(1,2-oxazol-4-yl)benzamide |
|---|---|
| PubChem CID | 62913787 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-(methylamino)-N-(1,2-oxazol-4-yl)benzamide |
| SMILES | CNc1ccccc1C(=O)Nc1cnoc1 |
| InChI | InChI=1S/C11H11N3O2/c1-12-10-5-3-2-4-9(10)11(15)14-8-6-13-16-7-8/h2-7,12H,1H3,(H,14,15) |
| InChIKey | QIBNMYHFDUTBAW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |