C15H17N3O4S — CID 71797749
N-(1,2-oxazol-4-yl)-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 71797749) has the molecular formula C15H17N3O4S and a molecular weight of 335.38 g/mol. Its IUPAC name is N-(1,2-oxazol-4-yl)-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(1,2-oxazol-4-yl)-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 71797749 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-(1,2-oxazol-4-yl)-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1cnoc1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C15H17N3O4S/c19-15(17-13-10-16-22-11-13)12-4-6-14(7-5-12)23(20,21)18-8-2-1-3-9-18/h4-7,10-11H,1-3,8-9H2,(H,17,19) |
| InChIKey | VKEYHURNQAKMQP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |