C13H15NO3S — CID 71804400
N-[3-(furan-3-yl)-3-hydroxypropyl]-4-methylthiophene-2-carboxamide (PubChem CID 71804400) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is N-[3-(furan-3-yl)-3-hydroxypropyl]-4-methylthiophene-2-carboxamide.
| Compound Name | N-[3-(furan-3-yl)-3-hydroxypropyl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 71804400 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | N-[3-(furan-3-yl)-3-hydroxypropyl]-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)NCCC(O)c2ccoc2)c1 |
| InChI | InChI=1S/C13H15NO3S/c1-9-6-12(18-8-9)13(16)14-4-2-11(15)10-3-5-17-7-10/h3,5-8,11,15H,2,4H2,1H3,(H,14,16) |
| InChIKey | GUYQXTFCXDCDNV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |