C16H10N6O3 — CID 71805133
N-(2-oxochromen-3-yl)-6-(1,2,4-triazol-1-yl)pyridazine-3-carboxamide (PubChem CID 71805133) has the molecular formula C16H10N6O3 and a molecular weight of 334.30 g/mol. Its IUPAC name is N-(2-oxochromen-3-yl)-6-(1,2,4-triazol-1-yl)pyridazine-3-carboxamide.
| Compound Name | N-(2-oxochromen-3-yl)-6-(1,2,4-triazol-1-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 71805133 |
| Molecular Formula | C16H10N6O3 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-(2-oxochromen-3-yl)-6-(1,2,4-triazol-1-yl)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1cc2ccccc2oc1=O)c1ccc(-n2cncn2)nn1 |
| InChI | InChI=1S/C16H10N6O3/c23-15(11-5-6-14(21-20-11)22-9-17-8-18-22)19-12-7-10-3-1-2-4-13(10)25-16(12)24/h1-9H,(H,19,23) |
| InChIKey | JHYQXLBKUHLJOZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|