C9H13N3O3 — CID 71807563
N-(2,4-dimethoxypyrimidin-5-yl)propanamide (PubChem CID 71807563) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(2,4-dimethoxypyrimidin-5-yl)propanamide.
| Compound Name | N-(2,4-dimethoxypyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 71807563 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-(2,4-dimethoxypyrimidin-5-yl)propanamide |
| SMILES | CCC(=O)Nc1cnc(OC)nc1OC |
| InChI | InChI=1S/C9H13N3O3/c1-4-7(13)11-6-5-10-9(15-3)12-8(6)14-2/h5H,4H2,1-3H3,(H,11,13) |
| InChIKey | WKBBVCRYMUWKGJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |