C16H21NO6S2 — CID 71809170
methyl 2-[1-[(E)-2-phenylethenyl]sulfonylpiperidin-4-yl]sulfonylacetate (PubChem CID 71809170) has the molecular formula C16H21NO6S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl 2-[1-[(E)-2-phenylethenyl]sulfonylpiperidin-4-yl]sulfonylacetate.
| Compound Name | methyl 2-[1-[(E)-2-phenylethenyl]sulfonylpiperidin-4-yl]sulfonylacetate |
|---|---|
| PubChem CID | 71809170 |
| Molecular Formula | C16H21NO6S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | methyl 2-[1-[(E)-2-phenylethenyl]sulfonylpiperidin-4-yl]sulfonylacetate |
| SMILES | COC(=O)CS(=O)(=O)C1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C16H21NO6S2/c1-23-16(18)13-24(19,20)15-7-10-17(11-8-15)25(21,22)12-9-14-5-3-2-4-6-14/h2-6,9,12,15H,7-8,10-11,13H2,1H3/b12-9+ |
| InChIKey | BYWGGTCYPRJSPZ-FMIVXFBMSA-N |
| XLogP | 1.04 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |