C15H18F3NO4S2 — CID 18723295
methyl 2-[4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl]sulfonylacetate (PubChem CID 18723295) has the molecular formula C15H18F3NO4S2 and a molecular weight of 397.44 g/mol. Its IUPAC name is methyl 2-[4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl]sulfonylacetate.
| Compound Name | methyl 2-[4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl]sulfonylacetate |
|---|---|
| PubChem CID | 18723295 |
| Molecular Formula | C15H18F3NO4S2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | methyl 2-[4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl]sulfonylacetate |
| SMILES | COC(=O)CS(=O)(=O)N1CCC(Sc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H18F3NO4S2/c1-23-14(20)10-25(21,22)19-8-6-13(7-9-19)24-12-4-2-11(3-5-12)15(16,17)18/h2-5,13H,6-10H2,1H3 |
| InChIKey | TWXMWXNNUWUPID-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |