About N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide
N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide (PubChem CID 71812032) has the molecular formula C20H26F2N4O
and a molecular weight of 376.45 g/mol. Its IUPAC name is N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide |
| PubChem CID | 71812032 |
| Molecular Formula | C20H26F2N4O |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide |
| SMILES | Cc1ccc2c(cnn2C2CCN(C(=O)N[C@H]3CCCCC3(F)F)CC2)c1 |
| InChI | InChI=1S/C20H26F2N4O/c1-14-5-6-17-15(12-14)13-23-26(17)16-7-10-25(11-8-16)19(27)24-18-4-2-3-9-20(18,21)22/h5-6,12-13,16,18H,2-4,7-11H2,1H3,(H,24,27)/t18-/m0/s1 |
| InChIKey | YRHKKMBBSLEJQG-SFHVURJKSA-N |
| XLogP | 4.27 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide?
The IUPAC name of N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide (CID 71812032) is N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide.
What is the SMILES notation for N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide?
The canonical SMILES for N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide is Cc1ccc2c(cnn2C2CCN(C(=O)N[C@H]3CCCCC3(F)F)CC2)c1.
What is the InChIKey of N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide?
The InChIKey is YRHKKMBBSLEJQG-SFHVURJKSA-N. The full InChI is InChI=1S/C20H26F2N4O/c1-14-5-6-17-15(12-14)13-23-26(17)16-7-10-25(11-8-16)19(27)24-18-4-2-3-9-20(18,21)22/h5-6,12-13,16,18H,2-4,7-11H2,1H3,(H,24,27)/t18-/m0/s1.
What are the key properties of N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide?
N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide has a molecular weight of 376.45 g/mol, XLogP of 4.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-2,2-difluorocyclohexyl]-4-(5-methylindazol-1-yl)piperidine-1-carboxamide is sourced from PubChem (CID 71812032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).