C15H22O4 — CID 71813624
methyl 5-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]pentanoate (PubChem CID 71813624) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl 5-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]pentanoate.
| Compound Name | methyl 5-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]pentanoate |
|---|---|
| PubChem CID | 71813624 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl 5-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]pentanoate |
| SMILES | COC(=O)CCCCC1=CC=C[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H22O4/c1-15(2)18-12-9-6-8-11(14(12)19-15)7-4-5-10-13(16)17-3/h6,8-9,12,14H,4-5,7,10H2,1-3H3/t12-,14+/m0/s1 |
| InChIKey | OFIYRSSWWFYKPQ-GXTWGEPZSA-N |
| XLogP | 2.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|