C25H17FN4O3 — CID 71815388
1-(4-fluorophenyl)-2-oxo-N-[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-4-yl]pyridine-3-carboxamide (PubChem CID 71815388) has the molecular formula C25H17FN4O3 and a molecular weight of 440.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-oxo-N-[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-4-yl]pyridine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-2-oxo-N-[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71815388 |
| Molecular Formula | C25H17FN4O3 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 1-(4-fluorophenyl)-2-oxo-N-[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-4-yl]pyridine-3-carboxamide |
| SMILES | O=C1Nc2cccc(NC(=O)c3cccn(-c4ccc(F)cc4)c3=O)c2/C1=C/c1ccc[nH]1 |
| InChI | InChI=1S/C25H17FN4O3/c26-15-8-10-17(11-9-15)30-13-3-5-18(25(30)33)23(31)28-20-6-1-7-21-22(20)19(24(32)29-21)14-16-4-2-12-27-16/h1-14,27H,(H,28,31)(H,29,32)/b19-14- |
| InChIKey | XDRNSONQGZAXAG-RGEXLXHISA-N |
| XLogP | 4.05 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|