C23H13FN2O4 — CID 71816545
5-fluoro-N-(4-hydroxy-9,10-dioxoanthracen-1-yl)-1H-indole-2-carboxamide (PubChem CID 71816545) has the molecular formula C23H13FN2O4 and a molecular weight of 400.37 g/mol. Its IUPAC name is 5-fluoro-N-(4-hydroxy-9,10-dioxoanthracen-1-yl)-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-(4-hydroxy-9,10-dioxoanthracen-1-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 71816545 |
| Molecular Formula | C23H13FN2O4 |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 5-fluoro-N-(4-hydroxy-9,10-dioxoanthracen-1-yl)-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(O)c2c1C(=O)c1ccccc1C2=O)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C23H13FN2O4/c24-12-5-6-15-11(9-12)10-17(25-15)23(30)26-16-7-8-18(27)20-19(16)21(28)13-3-1-2-4-14(13)22(20)29/h1-10,25,27H,(H,26,30) |
| InChIKey | ZMKCQAZDQPEQKN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|