C32H35NO4 — CID 71817041
tert-butyl N-[(E)-but-2-enoyl]-N-[(2R)-1-trityloxybut-3-en-2-yl]carbamate (PubChem CID 71817041) has the molecular formula C32H35NO4 and a molecular weight of 497.64 g/mol. Its IUPAC name is tert-butyl N-[(E)-but-2-enoyl]-N-[(2R)-1-trityloxybut-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E)-but-2-enoyl]-N-[(2R)-1-trityloxybut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 71817041 |
| Molecular Formula | C32H35NO4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | tert-butyl N-[(E)-but-2-enoyl]-N-[(2R)-1-trityloxybut-3-en-2-yl]carbamate |
| SMILES | C=C[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)N(C(=O)/C=C/C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H35NO4/c1-6-17-29(34)33(30(35)37-31(3,4)5)28(7-2)24-36-32(25-18-11-8-12-19-25,26-20-13-9-14-21-26)27-22-15-10-16-23-27/h6-23,28H,2,24H2,1,3-5H3/b17-6+/t28-/m1/s1 |
| InChIKey | GYLQWOLINNAOES-IDHZXDDJSA-N |
| XLogP | 6.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|