C19H15ClF7N3O2 — CID 71817780
9-(3-chloropropyl)-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 71817780) has the molecular formula C19H15ClF7N3O2 and a molecular weight of 485.79 g/mol. Its IUPAC name is 9-(3-chloropropyl)-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 9-(3-chloropropyl)-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 71817780 |
| Molecular Formula | C19H15ClF7N3O2 |
| Molecular Weight | 485.79 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 9-(3-chloropropyl)-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | Cn1c(=O)c2c(C(F)(F)C(F)(F)C(F)(F)F)c3cccc(CCCCl)c3nc2n(C)c1=O |
| InChI | InChI=1S/C19H15ClF7N3O2/c1-29-14-11(15(31)30(2)16(29)32)12(17(21,22)18(23,24)19(25,26)27)10-7-3-5-9(6-4-8-20)13(10)28-14/h3,5,7H,4,6,8H2,1-2H3 |
| InChIKey | AHUAWAKVLJEYNI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.79 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|