C17H27NO3 — CID 71818116
tert-butyl (1S,5R)-3-pent-4-enoyl-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 71818116) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl (1S,5R)-3-pent-4-enoyl-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1S,5R)-3-pent-4-enoyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 71818116 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | tert-butyl (1S,5R)-3-pent-4-enoyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=CCCC(=O)C1C[C@H]2CC[C@@H](C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27NO3/c1-5-6-7-15(19)12-10-13-8-9-14(11-12)18(13)16(20)21-17(2,3)4/h5,12-14H,1,6-11H2,2-4H3/t12?,13-,14+ |
| InChIKey | CJKIJWPTVKGYKC-AGUYFDCRSA-N |
| XLogP | 3.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|