C16H27NO3 — CID 18718005
tert-butyl (2R,6S)-2-methyl-6-(2-methylbut-3-enoyl)piperidine-1-carboxylate (PubChem CID 18718005) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is tert-butyl (2R,6S)-2-methyl-6-(2-methylbut-3-enoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,6S)-2-methyl-6-(2-methylbut-3-enoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18718005 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | tert-butyl (2R,6S)-2-methyl-6-(2-methylbut-3-enoyl)piperidine-1-carboxylate |
| SMILES | C=CC(C)C(=O)[C@@H]1CCC[C@@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO3/c1-7-11(2)14(18)13-10-8-9-12(3)17(13)15(19)20-16(4,5)6/h7,11-13H,1,8-10H2,2-6H3/t11?,12-,13+/m1/s1 |
| InChIKey | HQEMCFCMJUAYLQ-HDYSRYHKSA-N |
| XLogP | 3.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|