C18H31NO3 — CID 11045091
tert-butyl (3R,6R)-6-[(2S)-butan-2-yl]-3-(2-methylprop-2-enyl)-2-oxopiperidine-1-carboxylate (PubChem CID 11045091) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is tert-butyl (3R,6R)-6-[(2S)-butan-2-yl]-3-(2-methylprop-2-enyl)-2-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,6R)-6-[(2S)-butan-2-yl]-3-(2-methylprop-2-enyl)-2-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11045091 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | tert-butyl (3R,6R)-6-[(2S)-butan-2-yl]-3-(2-methylprop-2-enyl)-2-oxopiperidine-1-carboxylate |
| SMILES | C=C(C)C[C@H]1CC[C@H]([C@@H](C)CC)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C18H31NO3/c1-8-13(4)15-10-9-14(11-12(2)3)16(20)19(15)17(21)22-18(5,6)7/h13-15H,2,8-11H2,1,3-7H3/t13-,14+,15+/m0/s1 |
| InChIKey | NSEJWBYYYCLAIC-RRFJBIMHSA-N |
| XLogP | 4.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|