C18H27NO4 — CID 148864568
tert-butyl (2S)-5-(cyclopentanecarbonyl)-2-ethenyl-4-oxopiperidine-1-carboxylate (PubChem CID 148864568) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl (2S)-5-(cyclopentanecarbonyl)-2-ethenyl-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-5-(cyclopentanecarbonyl)-2-ethenyl-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 148864568 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | tert-butyl (2S)-5-(cyclopentanecarbonyl)-2-ethenyl-4-oxopiperidine-1-carboxylate |
| SMILES | C=C[C@@H]1CC(=O)C(C(=O)C2CCCC2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO4/c1-5-13-10-15(20)14(16(21)12-8-6-7-9-12)11-19(13)17(22)23-18(2,3)4/h5,12-14H,1,6-11H2,2-4H3/t13-,14?/m1/s1 |
| InChIKey | OZYWBCSFRDIEGL-KWCCSABGSA-N |
| XLogP | 3.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|