C14H9N3O2 — CID 71818201
2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid (PubChem CID 71818201) has the molecular formula C14H9N3O2 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid.
| Compound Name | 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid |
|---|---|
| PubChem CID | 71818201 |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid |
| SMILES | N#Cc1cccc2c(NCC(=O)O)ccc(C#N)c12 |
| InChI | InChI=1S/C14H9N3O2/c15-6-9-2-1-3-11-12(17-8-13(18)19)5-4-10(7-16)14(9)11/h1-5,17H,8H2,(H,18,19) |
| InChIKey | UVHGWOKYLGSFTF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |