2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid

C14H9N3O2 — CID 71818201

IUPAC2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid
SMILESN#Cc1cccc2c(NCC(=O)O)ccc(C#N)c12
InChIInChI=1S/C14H9N3O2/c15-6-9-2-1-3-11-12(17-8-13(18)19)5-4-10(7-16)14(9)11/h1-5,17H,8H2,(H,18,19)
InChIKeyUVHGWOKYLGSFTF-UHFFFAOYSA-N
MW251.24 g/mol
LogP2.08
Rot. Bonds3

About 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid

2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid (PubChem CID 71818201) has the molecular formula C14H9N3O2 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid.

Molecular Properties

Compound Name2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid
PubChem CID71818201
Molecular FormulaC14H9N3O2
Molecular Weight251.24 g/mol
Exact Mass251.07
IUPAC Name2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid
SMILESN#Cc1cccc2c(NCC(=O)O)ccc(C#N)c12
InChIInChI=1S/C14H9N3O2/c15-6-9-2-1-3-11-12(17-8-13(18)19)5-4-10(7-16)14(9)11/h1-5,17H,8H2,(H,18,19)
InChIKeyUVHGWOKYLGSFTF-UHFFFAOYSA-N
XLogP2.08
TPSA96.91 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.24
LogP ≤ 52.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid?
The IUPAC name of 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid (CID 71818201) is 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid.
What is the SMILES notation for 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid?
The canonical SMILES for 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid is N#Cc1cccc2c(NCC(=O)O)ccc(C#N)c12.
What is the InChIKey of 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid?
The InChIKey is UVHGWOKYLGSFTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O2/c15-6-9-2-1-3-11-12(17-8-13(18)19)5-4-10(7-16)14(9)11/h1-5,17H,8H2,(H,18,19).
What are the key properties of 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid?
2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid has a molecular weight of 251.24 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,5-dicyanonaphthalen-1-yl)amino]acetic acid is sourced from PubChem (CID 71818201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).