C26H16N2O2 — CID 155195590
4-(4,9-dicyanoperylen-3-yl)butanoic acid (PubChem CID 155195590) has the molecular formula C26H16N2O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-(4,9-dicyanoperylen-3-yl)butanoic acid.
| Compound Name | 4-(4,9-dicyanoperylen-3-yl)butanoic acid |
|---|---|
| PubChem CID | 155195590 |
| Molecular Formula | C26H16N2O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-(4,9-dicyanoperylen-3-yl)butanoic acid |
| SMILES | N#Cc1ccc2c3ccc(C#N)c4c(CCCC(=O)O)ccc(c5cccc1c25)c43 |
| InChI | InChI=1S/C26H16N2O2/c27-13-16-8-11-20-22-12-9-17(14-28)24-15(3-1-6-23(29)30)7-10-21(26(22)24)19-5-2-4-18(16)25(19)20/h2,4-5,7-12H,1,3,6H2,(H,29,30) |
| InChIKey | VYUWQBDHWOBWHZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|