About 4-(4,9-dicyanoperylen-3-yl)butanoic acid
4-(4,9-dicyanoperylen-3-yl)butanoic acid (PubChem CID 155195590) has the molecular formula C26H16N2O2
and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-(4,9-dicyanoperylen-3-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(4,9-dicyanoperylen-3-yl)butanoic acid |
| PubChem CID | 155195590 |
| Molecular Formula | C26H16N2O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-(4,9-dicyanoperylen-3-yl)butanoic acid |
| SMILES | N#Cc1ccc2c3ccc(C#N)c4c(CCCC(=O)O)ccc(c5cccc1c25)c43 |
| InChI | InChI=1S/C26H16N2O2/c27-13-16-8-11-20-22-12-9-17(14-28)24-15(3-1-6-23(29)30)7-10-21(26(22)24)19-5-2-4-18(16)25(19)20/h2,4-5,7-12H,1,3,6H2,(H,29,30) |
| InChIKey | VYUWQBDHWOBWHZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,9-dicyanoperylen-3-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,9-dicyanoperylen-3-yl)butanoic acid?
The IUPAC name of 4-(4,9-dicyanoperylen-3-yl)butanoic acid (CID 155195590) is 4-(4,9-dicyanoperylen-3-yl)butanoic acid.
What is the SMILES notation for 4-(4,9-dicyanoperylen-3-yl)butanoic acid?
The canonical SMILES for 4-(4,9-dicyanoperylen-3-yl)butanoic acid is N#Cc1ccc2c3ccc(C#N)c4c(CCCC(=O)O)ccc(c5cccc1c25)c43.
What is the InChIKey of 4-(4,9-dicyanoperylen-3-yl)butanoic acid?
The InChIKey is VYUWQBDHWOBWHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16N2O2/c27-13-16-8-11-20-22-12-9-17(14-28)24-15(3-1-6-23(29)30)7-10-21(26(22)24)19-5-2-4-18(16)25(19)20/h2,4-5,7-12H,1,3,6H2,(H,29,30).
What are the key properties of 4-(4,9-dicyanoperylen-3-yl)butanoic acid?
4-(4,9-dicyanoperylen-3-yl)butanoic acid has a molecular weight of 388.43 g/mol, XLogP of 5.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,9-dicyanoperylen-3-yl)butanoic acid is sourced from PubChem (CID 155195590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).