C25H16N2O3 — CID 152622907
2-[1-(2-amino-2-oxoethyl)-9-cyanoperylen-2-yl]acetic acid (PubChem CID 152622907) has the molecular formula C25H16N2O3 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[1-(2-amino-2-oxoethyl)-9-cyanoperylen-2-yl]acetic acid.
| Compound Name | 2-[1-(2-amino-2-oxoethyl)-9-cyanoperylen-2-yl]acetic acid |
|---|---|
| PubChem CID | 152622907 |
| Molecular Formula | C25H16N2O3 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[1-(2-amino-2-oxoethyl)-9-cyanoperylen-2-yl]acetic acid |
| SMILES | N#Cc1ccc2c3cccc4cc(CC(=O)O)c(CC(N)=O)c(c5cccc1c25)c43 |
| InChI | InChI=1S/C25H16N2O3/c26-12-14-7-8-18-17-5-1-3-13-9-15(10-22(29)30)20(11-21(27)28)25(23(13)17)19-6-2-4-16(14)24(18)19/h1-9H,10-11H2,(H2,27,28)(H,29,30) |
| InChIKey | ZBXCOALNCFXLTB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|