C27H20N2O2 — CID 159353664
2-methylbutanoic acid;perylene-3,10-dicarbonitrile (PubChem CID 159353664) has the molecular formula C27H20N2O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-methylbutanoic acid;perylene-3,10-dicarbonitrile.
| Compound Name | 2-methylbutanoic acid;perylene-3,10-dicarbonitrile |
|---|---|
| PubChem CID | 159353664 |
| Molecular Formula | C27H20N2O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-methylbutanoic acid;perylene-3,10-dicarbonitrile |
| SMILES | CCC(C)C(=O)O.N#Cc1ccc2c3ccc(C#N)c4cccc(c5cccc1c52)c43 |
| InChI | InChI=1S/C22H10N2.C5H10O2/c23-11-13-7-9-19-20-10-8-14(12-24)16-4-2-6-18(22(16)20)17-5-1-3-15(13)21(17)19;1-3-4(2)5(6)7/h1-10H;4H,3H2,1-2H3,(H,6,7) |
| InChIKey | LHQKJLOSCWJBFR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|