C28H12N8O2 — CID 89057627
4-(4,5,15,16-tetracyano-3,6,14,17-tetrazahexacyclo[10.10.2.02,7.08,24.013,18.019,23]tetracosa-1(22),2,4,6,8,10,12(24),13,15,17,19(23),20-dodecaen-9-yl)butanoic acid (PubChem CID 89057627) has the molecular formula C28H12N8O2 and a molecular weight of 492.46 g/mol. Its IUPAC name is 4-(4,5,15,16-tetracyano-3,6,14,17-tetrazahexacyclo[10.10.2.02,7.08,24.013,18.019,23]tetracosa-1(22),2,4,6,8,10,12(24),13,15,17,19(23),20-dodecaen-9-yl)butanoic acid.
| Compound Name | 4-(4,5,15,16-tetracyano-3,6,14,17-tetrazahexacyclo[10.10.2.02,7.08,24.013,18.019,23]tetracosa-1(22),2,4,6,8,10,12(24),13,15,17,19(23),20-dodecaen-9-yl)butanoic acid |
|---|---|
| PubChem CID | 89057627 |
| Molecular Formula | C28H12N8O2 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 4-(4,5,15,16-tetracyano-3,6,14,17-tetrazahexacyclo[10.10.2.02,7.08,24.013,18.019,23]tetracosa-1(22),2,4,6,8,10,12(24),13,15,17,19(23),20-dodecaen-9-yl)butanoic acid |
| SMILES | N#Cc1nc2c3cccc4c5nc(C#N)c(C#N)nc5c5c(CCCC(=O)O)ccc(c2nc1C#N)c5c34 |
| InChI | InChI=1S/C28H12N8O2/c29-9-17-18(10-30)34-26-16-8-7-13(3-1-6-21(37)38)22-24(16)23-14(25(26)33-17)4-2-5-15(23)27-28(22)36-20(12-32)19(11-31)35-27/h2,4-5,7-8H,1,3,6H2,(H,37,38) |
| InChIKey | PDSGAAXGNPFIPT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 184.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|